C7HBF7K2NO3 — CID 172796604
dipotassium;5-dioxidoboranyloxy-1,2,3,4,5,6,6-heptafluorocyclohex-3-ene-1-carbonitrile (PubChem CID 172796604) has the molecular formula C7HBF7K2NO3 and a molecular weight of 369.08 g/mol. Its IUPAC name is dipotassium;5-dioxidoboranyloxy-1,2,3,4,5,6,6-heptafluorocyclohex-3-ene-1-carbonitrile.
| Compound Name | dipotassium;5-dioxidoboranyloxy-1,2,3,4,5,6,6-heptafluorocyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 172796604 |
| Molecular Formula | C7HBF7K2NO3 |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | dipotassium;5-dioxidoboranyloxy-1,2,3,4,5,6,6-heptafluorocyclohex-3-ene-1-carbonitrile |
| SMILES | N#CC1(F)C(F)C(F)=C(F)C(F)(OB([O-])[O-])C1(F)F.[K+].[K+] |
| InChI | InChI=1S/C7HBF7NO3.2K/c9-2-3(10)5(12,1-16)7(14,15)6(13,4(2)11)19-8(17)18;;/h3H;;/q-2;2*+1 |
| InChIKey | QHBZJWPQYFSZAV-UHFFFAOYSA-N |
| XLogP | -6.25 |
| TPSA | 79.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|