C8H2ClF3N2 — CID 19094824
1-chloro-2,4,6-trifluorocyclohexa-3,5-diene-1,3-dicarbonitrile (PubChem CID 19094824) has the molecular formula C8H2ClF3N2 and a molecular weight of 218.57 g/mol. Its IUPAC name is 1-chloro-2,4,6-trifluorocyclohexa-3,5-diene-1,3-dicarbonitrile.
| Compound Name | 1-chloro-2,4,6-trifluorocyclohexa-3,5-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 19094824 |
| Molecular Formula | C8H2ClF3N2 |
| Molecular Weight | 218.57 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 1-chloro-2,4,6-trifluorocyclohexa-3,5-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=C(F)C=C(F)C(Cl)(C#N)C1F |
| InChI | InChI=1S/C8H2ClF3N2/c9-8(3-14)6(11)1-5(10)4(2-13)7(8)12/h1,7H |
| InChIKey | ZCGXJRAVDXVIRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|