About 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile
5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile (PubChem CID 150521115) has the molecular formula C9H4ClF3N2
and a molecular weight of 232.59 g/mol. Its IUPAC name is 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile |
| PubChem CID | 150521115 |
| Molecular Formula | C9H4ClF3N2 |
| Molecular Weight | 232.59 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=CC(Cl)(C(F)(F)F)CC(C#N)=C1 |
| InChI | InChI=1S/C9H4ClF3N2/c10-8(9(11,12)13)2-6(4-14)1-7(3-8)5-15/h1-2H,3H2 |
| InChIKey | IBWAYLUCTCRNRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile?
The IUPAC name of 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile (CID 150521115) is 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile.
What is the SMILES notation for 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile?
The canonical SMILES for 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile is N#CC1=CC(Cl)(C(F)(F)F)CC(C#N)=C1.
What is the InChIKey of 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile?
The InChIKey is IBWAYLUCTCRNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF3N2/c10-8(9(11,12)13)2-6(4-14)1-7(3-8)5-15/h1-2H,3H2.
What are the key properties of 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile?
5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile has a molecular weight of 232.59 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile is sourced from PubChem (CID 150521115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).