C9H4ClF3N2 — CID 150521115
5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile (PubChem CID 150521115) has the molecular formula C9H4ClF3N2 and a molecular weight of 232.59 g/mol. Its IUPAC name is 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile.
| Compound Name | 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 150521115 |
| Molecular Formula | C9H4ClF3N2 |
| Molecular Weight | 232.59 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 5-chloro-5-(trifluoromethyl)cyclohexa-1,3-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=CC(Cl)(C(F)(F)F)CC(C#N)=C1 |
| InChI | InChI=1S/C9H4ClF3N2/c10-8(9(11,12)13)2-6(4-14)1-7(3-8)5-15/h1-2H,3H2 |
| InChIKey | IBWAYLUCTCRNRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|