About dioxidoboranyloxy(dioxido)borane;zirconium(4+)
dioxidoboranyloxy(dioxido)borane;zirconium(4+) (PubChem CID 161331427) has the molecular formula B2O5Zr
and a molecular weight of 192.84 g/mol. Its IUPAC name is dioxidoboranyloxy(dioxido)borane;zirconium(4+).
Molecular Properties
| Compound Name | dioxidoboranyloxy(dioxido)borane;zirconium(4+) |
| PubChem CID | 161331427 |
| Molecular Formula | B2O5Zr |
| Molecular Weight | 192.84 g/mol |
| Exact Mass | 191.90 |
| IUPAC Name | dioxidoboranyloxy(dioxido)borane;zirconium(4+) |
| SMILES | [O-]B([O-])OB([O-])[O-].[Zr+4] |
| InChI | InChI=1S/B2O5.Zr/c3-1(4)7-2(5)6;/q-4;+4 |
| InChIKey | VLLUPIUAKVTATE-UHFFFAOYSA-N |
| XLogP | -5.59 |
| TPSA | 101.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.84 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxidoboranyloxy(dioxido)borane;zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxidoboranyloxy(dioxido)borane;zirconium(4+)?
The IUPAC name of dioxidoboranyloxy(dioxido)borane;zirconium(4+) (CID 161331427) is dioxidoboranyloxy(dioxido)borane;zirconium(4+).
What is the SMILES notation for dioxidoboranyloxy(dioxido)borane;zirconium(4+)?
The canonical SMILES for dioxidoboranyloxy(dioxido)borane;zirconium(4+) is [O-]B([O-])OB([O-])[O-].[Zr+4].
What is the InChIKey of dioxidoboranyloxy(dioxido)borane;zirconium(4+)?
The InChIKey is VLLUPIUAKVTATE-UHFFFAOYSA-N. The full InChI is InChI=1S/B2O5.Zr/c3-1(4)7-2(5)6;/q-4;+4.
What are the key properties of dioxidoboranyloxy(dioxido)borane;zirconium(4+)?
dioxidoboranyloxy(dioxido)borane;zirconium(4+) has a molecular weight of 192.84 g/mol, XLogP of -5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dioxidoboranyloxy(dioxido)borane;zirconium(4+) is sourced from PubChem (CID 161331427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).