About dioxidoboranyl hypoiodite;lead(2+)
dioxidoboranyl hypoiodite;lead(2+) (PubChem CID 174622308) has the molecular formula BIO3Pb
and a molecular weight of 392.91 g/mol. Its IUPAC name is dioxidoboranyl hypoiodite;lead(2+).
Molecular Properties
| Compound Name | dioxidoboranyl hypoiodite;lead(2+) |
| PubChem CID | 174622308 |
| Molecular Formula | BIO3Pb |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | dioxidoboranyl hypoiodite;lead(2+) |
| SMILES | [O-]B([O-])OI.[Pb+2] |
| InChI | InChI=1S/BIO3.Pb/c2-5-1(3)4;/q-2;+2 |
| InChIKey | FNQMWYWTPTWVBJ-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dioxidoboranyl hypoiodite;lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxidoboranyl hypoiodite;lead(2+)?
The IUPAC name of dioxidoboranyl hypoiodite;lead(2+) (CID 174622308) is dioxidoboranyl hypoiodite;lead(2+).
What is the SMILES notation for dioxidoboranyl hypoiodite;lead(2+)?
The canonical SMILES for dioxidoboranyl hypoiodite;lead(2+) is [O-]B([O-])OI.[Pb+2].
What is the InChIKey of dioxidoboranyl hypoiodite;lead(2+)?
The InChIKey is FNQMWYWTPTWVBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/BIO3.Pb/c2-5-1(3)4;/q-2;+2.
What are the key properties of dioxidoboranyl hypoiodite;lead(2+)?
dioxidoboranyl hypoiodite;lead(2+) has a molecular weight of 392.91 g/mol, XLogP of -2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxidoboranyl hypoiodite;lead(2+) is sourced from PubChem (CID 174622308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).