About ethenoxy(dioxido)borane
ethenoxy(dioxido)borane (PubChem CID 86654342) has the molecular formula C2H3BO3-2
and a molecular weight of 85.86 g/mol. Its IUPAC name is ethenoxy(dioxido)borane.
Molecular Properties
| Compound Name | ethenoxy(dioxido)borane |
| PubChem CID | 86654342 |
| Molecular Formula | C2H3BO3-2 |
| Molecular Weight | 85.86 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | ethenoxy(dioxido)borane |
| SMILES | C=COB([O-])[O-] |
| InChI | InChI=1S/C2H3BO3/c1-2-6-3(4)5/h2H,1H2/q-2 |
| InChIKey | YQDDBFGQAKKEIP-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.86 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenoxy(dioxido)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxy(dioxido)borane?
The IUPAC name of ethenoxy(dioxido)borane (CID 86654342) is ethenoxy(dioxido)borane.
What is the SMILES notation for ethenoxy(dioxido)borane?
The canonical SMILES for ethenoxy(dioxido)borane is C=COB([O-])[O-].
What is the InChIKey of ethenoxy(dioxido)borane?
The InChIKey is YQDDBFGQAKKEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BO3/c1-2-6-3(4)5/h2H,1H2/q-2.
What are the key properties of ethenoxy(dioxido)borane?
ethenoxy(dioxido)borane has a molecular weight of 85.86 g/mol, XLogP of -2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxy(dioxido)borane is sourced from PubChem (CID 86654342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).