About dipotassium;ethenoxy(dioxido)borane
dipotassium;ethenoxy(dioxido)borane (PubChem CID 142796642) has the molecular formula C2H3BK2O3
and a molecular weight of 164.05 g/mol. Its IUPAC name is dipotassium;ethenoxy(dioxido)borane.
Molecular Properties
| Compound Name | dipotassium;ethenoxy(dioxido)borane |
| PubChem CID | 142796642 |
| Molecular Formula | C2H3BK2O3 |
| Molecular Weight | 164.05 g/mol |
| Exact Mass | 163.94 |
| IUPAC Name | dipotassium;ethenoxy(dioxido)borane |
| SMILES | C=COB([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C2H3BO3.2K/c1-2-6-3(4)5;;/h2H,1H2;;/q-2;2*+1 |
| InChIKey | LCEQZZHASZSXPR-UHFFFAOYSA-N |
| XLogP | -8.14 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.05 |
| LogP ≤ 5 | -8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;ethenoxy(dioxido)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;ethenoxy(dioxido)borane?
The IUPAC name of dipotassium;ethenoxy(dioxido)borane (CID 142796642) is dipotassium;ethenoxy(dioxido)borane.
What is the SMILES notation for dipotassium;ethenoxy(dioxido)borane?
The canonical SMILES for dipotassium;ethenoxy(dioxido)borane is C=COB([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;ethenoxy(dioxido)borane?
The InChIKey is LCEQZZHASZSXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BO3.2K/c1-2-6-3(4)5;;/h2H,1H2;;/q-2;2*+1.
What are the key properties of dipotassium;ethenoxy(dioxido)borane?
dipotassium;ethenoxy(dioxido)borane has a molecular weight of 164.05 g/mol, XLogP of -8.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;ethenoxy(dioxido)borane is sourced from PubChem (CID 142796642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).