About dioxido(oxidooxy)borane;tris(rubidium(1+))
dioxido(oxidooxy)borane;tris(rubidium(1+)) (PubChem CID 173286288) has the molecular formula BO4Rb3
and a molecular weight of 331.21 g/mol. Its IUPAC name is dioxido(oxidooxy)borane;tris(rubidium(1+)).
Molecular Properties
| Compound Name | dioxido(oxidooxy)borane;tris(rubidium(1+)) |
| PubChem CID | 173286288 |
| Molecular Formula | BO4Rb3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 329.72 |
| IUPAC Name | dioxido(oxidooxy)borane;tris(rubidium(1+)) |
| SMILES | [O-]OB([O-])[O-].[Rb+].[Rb+].[Rb+] |
| InChI | InChI=1S/BHO4.3Rb/c2-1(3)5-4;;;/h4H;;;/q-2;3*+1/p-1 |
| InChIKey | RNZMICZGFQJVSF-UHFFFAOYSA-M |
| XLogP | -13.00 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | -13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxidooxy)borane;tris(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxidooxy)borane;tris(rubidium(1+))?
The IUPAC name of dioxido(oxidooxy)borane;tris(rubidium(1+)) (CID 173286288) is dioxido(oxidooxy)borane;tris(rubidium(1+)).
What is the SMILES notation for dioxido(oxidooxy)borane;tris(rubidium(1+))?
The canonical SMILES for dioxido(oxidooxy)borane;tris(rubidium(1+)) is [O-]OB([O-])[O-].[Rb+].[Rb+].[Rb+].
What is the InChIKey of dioxido(oxidooxy)borane;tris(rubidium(1+))?
The InChIKey is RNZMICZGFQJVSF-UHFFFAOYSA-M. The full InChI is InChI=1S/BHO4.3Rb/c2-1(3)5-4;;;/h4H;;;/q-2;3*+1/p-1.
What are the key properties of dioxido(oxidooxy)borane;tris(rubidium(1+))?
dioxido(oxidooxy)borane;tris(rubidium(1+)) has a molecular weight of 331.21 g/mol, XLogP of -13.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxidooxy)borane;tris(rubidium(1+)) is sourced from PubChem (CID 173286288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).