About beryllium;disodium;dioxidoboranyloxy(dioxido)borane
beryllium;disodium;dioxidoboranyloxy(dioxido)borane (PubChem CID 139072570) has the molecular formula B2BeNa2O5
and a molecular weight of 156.61 g/mol. Its IUPAC name is beryllium;disodium;dioxidoboranyloxy(dioxido)borane.
Molecular Properties
| Compound Name | beryllium;disodium;dioxidoboranyloxy(dioxido)borane |
| PubChem CID | 139072570 |
| Molecular Formula | B2BeNa2O5 |
| Molecular Weight | 156.61 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | beryllium;disodium;dioxidoboranyloxy(dioxido)borane |
| SMILES | [Be+2].[Na+].[Na+].[O-]B([O-])OB([O-])[O-] |
| InChI | InChI=1S/B2O5.Be.2Na/c3-1(4)7-2(5)6;;;/q-4;+2;2*+1 |
| InChIKey | NJQMICDALWYQMT-UHFFFAOYSA-N |
| XLogP | -11.96 |
| TPSA | 101.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.61 |
| LogP ≤ 5 | -11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze beryllium;disodium;dioxidoboranyloxy(dioxido)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;disodium;dioxidoboranyloxy(dioxido)borane?
The IUPAC name of beryllium;disodium;dioxidoboranyloxy(dioxido)borane (CID 139072570) is beryllium;disodium;dioxidoboranyloxy(dioxido)borane.
What is the SMILES notation for beryllium;disodium;dioxidoboranyloxy(dioxido)borane?
The canonical SMILES for beryllium;disodium;dioxidoboranyloxy(dioxido)borane is [Be+2].[Na+].[Na+].[O-]B([O-])OB([O-])[O-].
What is the InChIKey of beryllium;disodium;dioxidoboranyloxy(dioxido)borane?
The InChIKey is NJQMICDALWYQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/B2O5.Be.2Na/c3-1(4)7-2(5)6;;;/q-4;+2;2*+1.
What are the key properties of beryllium;disodium;dioxidoboranyloxy(dioxido)borane?
beryllium;disodium;dioxidoboranyloxy(dioxido)borane has a molecular weight of 156.61 g/mol, XLogP of -11.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;disodium;dioxidoboranyloxy(dioxido)borane is sourced from PubChem (CID 139072570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).