About chloro(dioxido)borane;manganese(2+)
chloro(dioxido)borane;manganese(2+) (PubChem CID 175164810) has the molecular formula BClMnO2
and a molecular weight of 133.20 g/mol. Its IUPAC name is chloro(dioxido)borane;manganese(2+).
Molecular Properties
| Compound Name | chloro(dioxido)borane;manganese(2+) |
| PubChem CID | 175164810 |
| Molecular Formula | BClMnO2 |
| Molecular Weight | 133.20 g/mol |
| Exact Mass | 132.91 |
| IUPAC Name | chloro(dioxido)borane;manganese(2+) |
| SMILES | [Mn+2].[O-]B([O-])Cl |
| InChI | InChI=1S/BClO2.Mn/c2-1(3)4;/q-2;+2 |
| InChIKey | BIVRZCZJQCGABY-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.20 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloro(dioxido)borane;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dioxido)borane;manganese(2+)?
The IUPAC name of chloro(dioxido)borane;manganese(2+) (CID 175164810) is chloro(dioxido)borane;manganese(2+).
What is the SMILES notation for chloro(dioxido)borane;manganese(2+)?
The canonical SMILES for chloro(dioxido)borane;manganese(2+) is [Mn+2].[O-]B([O-])Cl.
What is the InChIKey of chloro(dioxido)borane;manganese(2+)?
The InChIKey is BIVRZCZJQCGABY-UHFFFAOYSA-N. The full InChI is InChI=1S/BClO2.Mn/c2-1(3)4;/q-2;+2.
What are the key properties of chloro(dioxido)borane;manganese(2+)?
chloro(dioxido)borane;manganese(2+) has a molecular weight of 133.20 g/mol, XLogP of -2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dioxido)borane;manganese(2+) is sourced from PubChem (CID 175164810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).