About calcium;chloro(dioxido)borane;phosphane
calcium;chloro(dioxido)borane;phosphane (PubChem CID 172820031) has the molecular formula H3BCaClO2P
and a molecular weight of 152.34 g/mol. Its IUPAC name is calcium;chloro(dioxido)borane;phosphane.
Molecular Properties
| Compound Name | calcium;chloro(dioxido)borane;phosphane |
| PubChem CID | 172820031 |
| Molecular Formula | H3BCaClO2P |
| Molecular Weight | 152.34 g/mol |
| Exact Mass | 151.93 |
| IUPAC Name | calcium;chloro(dioxido)borane;phosphane |
| SMILES | P.[Ca+2].[O-]B([O-])Cl |
| InChI | InChI=1S/BClO2.Ca.H3P/c2-1(3)4;;/h;;1H3/q-2;+2; |
| InChIKey | UCHVJPJVMYREPZ-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.34 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;chloro(dioxido)borane;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;chloro(dioxido)borane;phosphane?
The IUPAC name of calcium;chloro(dioxido)borane;phosphane (CID 172820031) is calcium;chloro(dioxido)borane;phosphane.
What is the SMILES notation for calcium;chloro(dioxido)borane;phosphane?
The canonical SMILES for calcium;chloro(dioxido)borane;phosphane is P.[Ca+2].[O-]B([O-])Cl.
What is the InChIKey of calcium;chloro(dioxido)borane;phosphane?
The InChIKey is UCHVJPJVMYREPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/BClO2.Ca.H3P/c2-1(3)4;;/h;;1H3/q-2;+2;.
What are the key properties of calcium;chloro(dioxido)borane;phosphane?
calcium;chloro(dioxido)borane;phosphane has a molecular weight of 152.34 g/mol, XLogP of -2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;chloro(dioxido)borane;phosphane is sourced from PubChem (CID 172820031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).