About calcium;lithium;borate
calcium;lithium;borate (PubChem CID 139040925) has the molecular formula BCaLiO3
and a molecular weight of 105.83 g/mol. Its IUPAC name is calcium;lithium;borate.
Molecular Properties
| Compound Name | calcium;lithium;borate |
| PubChem CID | 139040925 |
| Molecular Formula | BCaLiO3 |
| Molecular Weight | 105.83 g/mol |
| Exact Mass | 105.97 |
| IUPAC Name | calcium;lithium;borate |
| SMILES | [Ca+2].[Li+].[O-]B([O-])[O-] |
| InChI | InChI=1S/BO3.Ca.Li/c2-1(3)4;;/q-3;+2;+1 |
| InChIKey | MEQOSCYFKJPQKH-UHFFFAOYSA-N |
| XLogP | -7.32 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.83 |
| LogP ≤ 5 | -7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze calcium;lithium;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;lithium;borate?
The IUPAC name of calcium;lithium;borate (CID 139040925) is calcium;lithium;borate.
What is the SMILES notation for calcium;lithium;borate?
The canonical SMILES for calcium;lithium;borate is [Ca+2].[Li+].[O-]B([O-])[O-].
What is the InChIKey of calcium;lithium;borate?
The InChIKey is MEQOSCYFKJPQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/BO3.Ca.Li/c2-1(3)4;;/q-3;+2;+1.
What are the key properties of calcium;lithium;borate?
calcium;lithium;borate has a molecular weight of 105.83 g/mol, XLogP of -7.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;lithium;borate is sourced from PubChem (CID 139040925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).