About trisulfanium;borate
trisulfanium;borate (PubChem CID 22561123) has the molecular formula H9BO3S3
and a molecular weight of 164.08 g/mol. Its IUPAC name is trisulfanium;borate.
Molecular Properties
| Compound Name | trisulfanium;borate |
| PubChem CID | 22561123 |
| Molecular Formula | H9BO3S3 |
| Molecular Weight | 164.08 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | trisulfanium;borate |
| SMILES | [O-]B([O-])[O-].[SH3+].[SH3+].[SH3+] |
| InChI | InChI=1S/BO3.3H2S/c2-1(3)4;;;/h;3*1H2/q-3;;;/p+3 |
| InChIKey | GXKGVCRNWCFHSA-UHFFFAOYSA-Q |
| XLogP | -6.36 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.08 |
| LogP ≤ 5 | -6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trisulfanium;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisulfanium;borate?
The IUPAC name of trisulfanium;borate (CID 22561123) is trisulfanium;borate.
What is the SMILES notation for trisulfanium;borate?
The canonical SMILES for trisulfanium;borate is [O-]B([O-])[O-].[SH3+].[SH3+].[SH3+].
What is the InChIKey of trisulfanium;borate?
The InChIKey is GXKGVCRNWCFHSA-UHFFFAOYSA-Q. The full InChI is InChI=1S/BO3.3H2S/c2-1(3)4;;;/h;3*1H2/q-3;;;/p+3.
What are the key properties of trisulfanium;borate?
trisulfanium;borate has a molecular weight of 164.08 g/mol, XLogP of -6.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisulfanium;borate is sourced from PubChem (CID 22561123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).