About gadolinium(3+);zinc;borate
gadolinium(3+);zinc;borate (PubChem CID 173199381) has the molecular formula BGdO3Zn
and a molecular weight of 281.45 g/mol. Its IUPAC name is gadolinium(3+);zinc;borate.
Molecular Properties
| Compound Name | gadolinium(3+);zinc;borate |
| PubChem CID | 173199381 |
| Molecular Formula | BGdO3Zn |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 280.85 |
| IUPAC Name | gadolinium(3+);zinc;borate |
| SMILES | [Gd+3].[O-]B([O-])[O-].[Zn] |
| InChI | InChI=1S/BO3.Gd.Zn/c2-1(3)4;;/q-3;+3; |
| InChIKey | UWTHHFBAHVXHRN-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze gadolinium(3+);zinc;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gadolinium(3+);zinc;borate?
The IUPAC name of gadolinium(3+);zinc;borate (CID 173199381) is gadolinium(3+);zinc;borate.
What is the SMILES notation for gadolinium(3+);zinc;borate?
The canonical SMILES for gadolinium(3+);zinc;borate is [Gd+3].[O-]B([O-])[O-].[Zn].
What is the InChIKey of gadolinium(3+);zinc;borate?
The InChIKey is UWTHHFBAHVXHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/BO3.Gd.Zn/c2-1(3)4;;/q-3;+3;.
What are the key properties of gadolinium(3+);zinc;borate?
gadolinium(3+);zinc;borate has a molecular weight of 281.45 g/mol, XLogP of -3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for gadolinium(3+);zinc;borate is sourced from PubChem (CID 173199381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).