About trisodium;borate;trihydrate
trisodium;borate;trihydrate (PubChem CID 141011813) has the molecular formula H6BNa3O6
and a molecular weight of 181.82 g/mol. Its IUPAC name is trisodium;borate;trihydrate.
Molecular Properties
| Compound Name | trisodium;borate;trihydrate |
| PubChem CID | 141011813 |
| Molecular Formula | H6BNa3O6 |
| Molecular Weight | 181.82 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | trisodium;borate;trihydrate |
| SMILES | O.O.O.[Na+].[Na+].[Na+].[O-]B([O-])[O-] |
| InChI | InChI=1S/BO3.3Na.3H2O/c2-1(3)4;;;;;;/h;;;;3*1H2/q-3;3*+1;;; |
| InChIKey | MAYDHPBXPJUUEY-UHFFFAOYSA-N |
| XLogP | -15.41 |
| TPSA | 163.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.82 |
| LogP ≤ 5 | -15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trisodium;borate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;borate;trihydrate?
The IUPAC name of trisodium;borate;trihydrate (CID 141011813) is trisodium;borate;trihydrate.
What is the SMILES notation for trisodium;borate;trihydrate?
The canonical SMILES for trisodium;borate;trihydrate is O.O.O.[Na+].[Na+].[Na+].[O-]B([O-])[O-].
What is the InChIKey of trisodium;borate;trihydrate?
The InChIKey is MAYDHPBXPJUUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/BO3.3Na.3H2O/c2-1(3)4;;;;;;/h;;;;3*1H2/q-3;3*+1;;;.
What are the key properties of trisodium;borate;trihydrate?
trisodium;borate;trihydrate has a molecular weight of 181.82 g/mol, XLogP of -15.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;borate;trihydrate is sourced from PubChem (CID 141011813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).