lithium;hydride;iodooxyboronic acid

H3BILiO3 — CID 174461573

IUPAClithium;hydride;iodooxyboronic acid
SMILESOB(O)OI.[H-].[Li+]
InChIInChI=1S/BH2IO3.Li.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1
InChIKeyTXFWCHBZMSUJCJ-UHFFFAOYSA-N
MW195.68 g/mol
LogP-3.56
Rot. Bonds1

About lithium;hydride;iodooxyboronic acid

lithium;hydride;iodooxyboronic acid (PubChem CID 174461573) has the molecular formula H3BILiO3 and a molecular weight of 195.68 g/mol. Its IUPAC name is lithium;hydride;iodooxyboronic acid.

Molecular Properties

Compound Namelithium;hydride;iodooxyboronic acid
PubChem CID174461573
Molecular FormulaH3BILiO3
Molecular Weight195.68 g/mol
Exact Mass195.94
IUPAC Namelithium;hydride;iodooxyboronic acid
SMILESOB(O)OI.[H-].[Li+]
InChIInChI=1S/BH2IO3.Li.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1
InChIKeyTXFWCHBZMSUJCJ-UHFFFAOYSA-N
XLogP-3.56
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.68
LogP ≤ 5-3.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze lithium;hydride;iodooxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium;hydride;iodooxyboronic acid?
The IUPAC name of lithium;hydride;iodooxyboronic acid (CID 174461573) is lithium;hydride;iodooxyboronic acid.
What is the SMILES notation for lithium;hydride;iodooxyboronic acid?
The canonical SMILES for lithium;hydride;iodooxyboronic acid is OB(O)OI.[H-].[Li+].
What is the InChIKey of lithium;hydride;iodooxyboronic acid?
The InChIKey is TXFWCHBZMSUJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/BH2IO3.Li.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1.
What are the key properties of lithium;hydride;iodooxyboronic acid?
lithium;hydride;iodooxyboronic acid has a molecular weight of 195.68 g/mol, XLogP of -3.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;iodooxyboronic acid is sourced from PubChem (CID 174461573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).