About lithium;hydride;iodooxyboronic acid
lithium;hydride;iodooxyboronic acid (PubChem CID 174461573) has the molecular formula H3BILiO3
and a molecular weight of 195.68 g/mol. Its IUPAC name is lithium;hydride;iodooxyboronic acid.
Molecular Properties
| Compound Name | lithium;hydride;iodooxyboronic acid |
| PubChem CID | 174461573 |
| Molecular Formula | H3BILiO3 |
| Molecular Weight | 195.68 g/mol |
| Exact Mass | 195.94 |
| IUPAC Name | lithium;hydride;iodooxyboronic acid |
| SMILES | OB(O)OI.[H-].[Li+] |
| InChI | InChI=1S/BH2IO3.Li.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1 |
| InChIKey | TXFWCHBZMSUJCJ-UHFFFAOYSA-N |
| XLogP | -3.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.68 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;iodooxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;iodooxyboronic acid?
The IUPAC name of lithium;hydride;iodooxyboronic acid (CID 174461573) is lithium;hydride;iodooxyboronic acid.
What is the SMILES notation for lithium;hydride;iodooxyboronic acid?
The canonical SMILES for lithium;hydride;iodooxyboronic acid is OB(O)OI.[H-].[Li+].
What is the InChIKey of lithium;hydride;iodooxyboronic acid?
The InChIKey is TXFWCHBZMSUJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/BH2IO3.Li.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1.
What are the key properties of lithium;hydride;iodooxyboronic acid?
lithium;hydride;iodooxyboronic acid has a molecular weight of 195.68 g/mol, XLogP of -3.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;iodooxyboronic acid is sourced from PubChem (CID 174461573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).