About potassium;chlorooxyboronic acid;hydride
potassium;chlorooxyboronic acid;hydride (PubChem CID 173014340) has the molecular formula H3BClKO3
and a molecular weight of 136.38 g/mol. Its IUPAC name is potassium;chlorooxyboronic acid;hydride.
Molecular Properties
| Compound Name | potassium;chlorooxyboronic acid;hydride |
| PubChem CID | 173014340 |
| Molecular Formula | H3BClKO3 |
| Molecular Weight | 136.38 g/mol |
| Exact Mass | 135.95 |
| IUPAC Name | potassium;chlorooxyboronic acid;hydride |
| SMILES | OB(O)OCl.[H-].[K+] |
| InChI | InChI=1S/BClH2O3.K.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1 |
| InChIKey | SUYRLKOAIJOCEY-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.38 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;chlorooxyboronic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;chlorooxyboronic acid;hydride?
The IUPAC name of potassium;chlorooxyboronic acid;hydride (CID 173014340) is potassium;chlorooxyboronic acid;hydride.
What is the SMILES notation for potassium;chlorooxyboronic acid;hydride?
The canonical SMILES for potassium;chlorooxyboronic acid;hydride is OB(O)OCl.[H-].[K+].
What is the InChIKey of potassium;chlorooxyboronic acid;hydride?
The InChIKey is SUYRLKOAIJOCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/BClH2O3.K.H/c2-5-1(3)4;;/h3-4H;;/q;+1;-1.
What are the key properties of potassium;chlorooxyboronic acid;hydride?
potassium;chlorooxyboronic acid;hydride has a molecular weight of 136.38 g/mol, XLogP of -3.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;chlorooxyboronic acid;hydride is sourced from PubChem (CID 173014340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).