C7H4F10 — CID 154317052
1,1,2,2,3,3,4,4,5,6-decafluoro-5-methylcyclohexane (PubChem CID 154317052) has the molecular formula C7H4F10 and a molecular weight of 278.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6-decafluoro-5-methylcyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5-methylcyclohexane |
|---|---|
| PubChem CID | 154317052 |
| Molecular Formula | C7H4F10 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6-decafluoro-5-methylcyclohexane |
| SMILES | CC1(F)C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H4F10/c1-3(9)2(8)4(10,11)6(14,15)7(16,17)5(3,12)13/h2H,1H3 |
| InChIKey | SMQZYPAYSVYSES-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|