C9H10F8O — CID 58114502
1-butoxy-1,2,2,3,3,4,4,5-octafluorocyclopentane (PubChem CID 58114502) has the molecular formula C9H10F8O and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-butoxy-1,2,2,3,3,4,4,5-octafluorocyclopentane.
| Compound Name | 1-butoxy-1,2,2,3,3,4,4,5-octafluorocyclopentane |
|---|---|
| PubChem CID | 58114502 |
| Molecular Formula | C9H10F8O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-butoxy-1,2,2,3,3,4,4,5-octafluorocyclopentane |
| SMILES | CCCCOC1(F)C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F8O/c1-2-3-4-18-7(13)5(10)6(11,12)8(14,15)9(7,16)17/h5H,2-4H2,1H3 |
| InChIKey | NIEHMCJYUVPQIN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|