About 3-butoxy-3-methyldioxirane;titanium
3-butoxy-3-methyldioxirane;titanium (PubChem CID 175327967) has the molecular formula C6H12O3Ti
and a molecular weight of 180.03 g/mol. Its IUPAC name is 3-butoxy-3-methyldioxirane;titanium.
Molecular Properties
| Compound Name | 3-butoxy-3-methyldioxirane;titanium |
| PubChem CID | 175327967 |
| Molecular Formula | C6H12O3Ti |
| Molecular Weight | 180.03 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 3-butoxy-3-methyldioxirane;titanium |
| SMILES | CCCCOC1(C)OO1.[Ti] |
| InChI | InChI=1S/C6H12O3.Ti/c1-3-4-5-7-6(2)8-9-6;/h3-5H2,1-2H3; |
| InChIKey | WGDRLUAAICHQPF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.03 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-3-methyldioxirane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-3-methyldioxirane;titanium?
The IUPAC name of 3-butoxy-3-methyldioxirane;titanium (CID 175327967) is 3-butoxy-3-methyldioxirane;titanium.
What is the SMILES notation for 3-butoxy-3-methyldioxirane;titanium?
The canonical SMILES for 3-butoxy-3-methyldioxirane;titanium is CCCCOC1(C)OO1.[Ti].
What is the InChIKey of 3-butoxy-3-methyldioxirane;titanium?
The InChIKey is WGDRLUAAICHQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.Ti/c1-3-4-5-7-6(2)8-9-6;/h3-5H2,1-2H3;.
What are the key properties of 3-butoxy-3-methyldioxirane;titanium?
3-butoxy-3-methyldioxirane;titanium has a molecular weight of 180.03 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-3-methyldioxirane;titanium is sourced from PubChem (CID 175327967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).