C10H13F7O — CID 134604963
(2,2,3,3,4,4,6-heptafluoro-5,5,6-trimethylcyclohexyl)methanol (PubChem CID 134604963) has the molecular formula C10H13F7O and a molecular weight of 282.20 g/mol. Its IUPAC name is (2,2,3,3,4,4,6-heptafluoro-5,5,6-trimethylcyclohexyl)methanol.
| Compound Name | (2,2,3,3,4,4,6-heptafluoro-5,5,6-trimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 134604963 |
| Molecular Formula | C10H13F7O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2,2,3,3,4,4,6-heptafluoro-5,5,6-trimethylcyclohexyl)methanol |
| SMILES | CC1(F)C(CO)C(F)(F)C(F)(F)C(F)(F)C1(C)C |
| InChI | InChI=1S/C10H13F7O/c1-6(2)7(3,11)5(4-18)8(12,13)10(16,17)9(6,14)15/h5,18H,4H2,1-3H3 |
| InChIKey | DQCDOZOVKCNIQG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|