C15H17F11 — CID 22642483
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6,7,7,8,8-pentamethyl-4a,8a-dihydronaphthalene (PubChem CID 22642483) has the molecular formula C15H17F11 and a molecular weight of 406.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6,7,7,8,8-pentamethyl-4a,8a-dihydronaphthalene.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6,7,7,8,8-pentamethyl-4a,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 22642483 |
| Molecular Formula | C15H17F11 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6,7,7,8,8-pentamethyl-4a,8a-dihydronaphthalene |
| SMILES | CC1(C)C2C(C(F)(F)C(C)(F)C1(C)C)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C15H17F11/c1-8(2)6-7(11(17,18)10(5,16)9(8,3)4)13(21,22)15(25,26)14(23,24)12(6,19)20/h6-7H,1-5H3 |
| InChIKey | ORKLFXOROWBAQK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|