C7F8 — CID 171853780
1,2,3,4,5-pentafluoro-5-(1,2,2-trifluoroethenyl)cyclopenta-1,3-diene (PubChem CID 171853780) has the molecular formula C7F8 and a molecular weight of 236.06 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-5-(1,2,2-trifluoroethenyl)cyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentafluoro-5-(1,2,2-trifluoroethenyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 171853780 |
| Molecular Formula | C7F8 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-5-(1,2,2-trifluoroethenyl)cyclopenta-1,3-diene |
| SMILES | FC(F)=C(F)C1(F)C(F)=C(F)C(F)=C1F |
| InChI | InChI=1S/C7F8/c8-1-2(9)4(11)7(15,3(1)10)5(12)6(13)14 |
| InChIKey | UWKZJTYOWHBYAL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |