C6HF5O2 — CID 154636951
2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol (PubChem CID 154636951) has the molecular formula C6HF5O2 and a molecular weight of 200.06 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol.
| Compound Name | 2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 154636951 |
| Molecular Formula | C6HF5O2 |
| Molecular Weight | 200.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol |
| SMILES | OC12OC1(F)C(F)=C(F)C(F)=C2F |
| InChI | InChI=1S/C6HF5O2/c7-1-2(8)4(10)6(12)5(11,13-6)3(1)9/h12H |
| InChIKey | VXMYOURFVXJMMJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.06 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|