C8H5F5O — CID 91620439
1-ethyl-2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 91620439) has the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 1-ethyl-2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 91620439 |
| Molecular Formula | C8H5F5O |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1-ethyl-2,3,4,5,6-pentafluoro-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CCC12OC1(F)C(F)=C(F)C(F)=C2F |
| InChI | InChI=1S/C8H5F5O/c1-2-7-5(11)3(9)4(10)6(12)8(7,13)14-7/h2H2,1H3 |
| InChIKey | JXEHWGGUSSBJOS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|