C5F8O2 — CID 174791140
3,3,4,5-tetrafluorodioxole;1,1,2,2-tetrafluoroethene (PubChem CID 174791140) has the molecular formula C5F8O2 and a molecular weight of 244.04 g/mol. Its IUPAC name is 3,3,4,5-tetrafluorodioxole;1,1,2,2-tetrafluoroethene.
| Compound Name | 3,3,4,5-tetrafluorodioxole;1,1,2,2-tetrafluoroethene |
|---|---|
| PubChem CID | 174791140 |
| Molecular Formula | C5F8O2 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 3,3,4,5-tetrafluorodioxole;1,1,2,2-tetrafluoroethene |
| SMILES | FC(F)=C(F)F.FC1=C(F)C(F)(F)OO1 |
| InChI | InChI=1S/C3F4O2.C2F4/c4-1-2(5)8-9-3(1,6)7;3-1(4)2(5)6 |
| InChIKey | KCZMOYSGHXMCIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|