C17H16F6N2O2 — CID 174658952
N-carbamoylbenzamide;1,2,3,4,5,6-hexafluoro-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 174658952) has the molecular formula C17H16F6N2O2 and a molecular weight of 394.32 g/mol. Its IUPAC name is N-carbamoylbenzamide;1,2,3,4,5,6-hexafluoro-5-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | N-carbamoylbenzamide;1,2,3,4,5,6-hexafluoro-5-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174658952 |
| Molecular Formula | C17H16F6N2O2 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-carbamoylbenzamide;1,2,3,4,5,6-hexafluoro-5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC(C)C1(F)C(F)=C(F)C(F)=C(F)C1F.NC(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H8F6.C8H8N2O2/c1-3(2)9(15)7(13)5(11)4(10)6(12)8(9)14;9-8(12)10-7(11)6-4-2-1-3-5-6/h3,7H,1-2H3;1-5H,(H3,9,10,11,12) |
| InChIKey | YBPKWUPUXZWHRP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |