C6H2ClF5O4S — CID 174432799
4-chloro-2,3,5,6-tetrafluoro-4-fluorooxycyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 174432799) has the molecular formula C6H2ClF5O4S and a molecular weight of 300.59 g/mol. Its IUPAC name is 4-chloro-2,3,5,6-tetrafluoro-4-fluorooxycyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-chloro-2,3,5,6-tetrafluoro-4-fluorooxycyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 174432799 |
| Molecular Formula | C6H2ClF5O4S |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 299.93 |
| IUPAC Name | 4-chloro-2,3,5,6-tetrafluoro-4-fluorooxycyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1=C(F)C(F)C(Cl)(OF)C(F)=C1F |
| InChI | InChI=1S/C6H2ClF5O4S/c7-6(16-12)4(10)1(8)3(17(13,14)15)2(9)5(6)11/h4H,(H,13,14,15) |
| InChIKey | WXPVJVSFFMRWBQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|