C6HF4NaO4S — CID 100932916
sodium 2,3,5,6-tetrafluoro-4-sulfophenolate (PubChem CID 100932916) has the molecular formula C6HF4NaO4S and a molecular weight of 268.12 g/mol. Its IUPAC name is sodium 2,3,5,6-tetrafluoro-4-sulfophenolate.
| Compound Name | sodium 2,3,5,6-tetrafluoro-4-sulfophenolate |
|---|---|
| PubChem CID | 100932916 |
| Molecular Formula | C6HF4NaO4S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | sodium 2,3,5,6-tetrafluoro-4-sulfophenolate |
| SMILES | O=S(=O)(O)c1c(F)c(F)c([O-])c(F)c1F.[Na+] |
| InChI | InChI=1S/C6H2F4O4S.Na/c7-1-3(9)6(15(12,13)14)4(10)2(8)5(1)11;/h11H,(H,12,13,14);/q;+1/p-1 |
| InChIKey | HVXPVJLSYQBYCR-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|