C10H10F4O3S2 — CID 118629625
2,3,5,6-tetrafluoro-4-(2-methylpropylsulfanyl)benzenesulfonic acid (PubChem CID 118629625) has the molecular formula C10H10F4O3S2 and a molecular weight of 318.31 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2-methylpropylsulfanyl)benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2-methylpropylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 118629625 |
| Molecular Formula | C10H10F4O3S2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2-methylpropylsulfanyl)benzenesulfonic acid |
| SMILES | CC(C)CSc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H10F4O3S2/c1-4(2)3-18-9-5(11)7(13)10(19(15,16)17)8(14)6(9)12/h4H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | PFDQMFPTKYWJQF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|