C14H15F7O3S — CID 155347177
4-fluoro-3,5-di(propan-2-yl)-2,6-bis(trifluoromethyl)benzenesulfonic acid (PubChem CID 155347177) has the molecular formula C14H15F7O3S and a molecular weight of 396.32 g/mol. Its IUPAC name is 4-fluoro-3,5-di(propan-2-yl)-2,6-bis(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 4-fluoro-3,5-di(propan-2-yl)-2,6-bis(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 155347177 |
| Molecular Formula | C14H15F7O3S |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-fluoro-3,5-di(propan-2-yl)-2,6-bis(trifluoromethyl)benzenesulfonic acid |
| SMILES | CC(C)c1c(F)c(C(C)C)c(C(F)(F)F)c(S(=O)(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C14H15F7O3S/c1-5(2)7-9(13(16,17)18)12(25(22,23)24)10(14(19,20)21)8(6(3)4)11(7)15/h5-6H,1-4H3,(H,22,23,24) |
| InChIKey | HMPUWNBERANSCT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|