C17H14F6O3S — CID 118048676
4-[(4-butan-2-ylphenyl)-difluoromethyl]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 118048676) has the molecular formula C17H14F6O3S and a molecular weight of 412.35 g/mol. Its IUPAC name is 4-[(4-butan-2-ylphenyl)-difluoromethyl]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[(4-butan-2-ylphenyl)-difluoromethyl]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 118048676 |
| Molecular Formula | C17H14F6O3S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-[(4-butan-2-ylphenyl)-difluoromethyl]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1ccc(C(F)(F)c2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F6O3S/c1-3-8(2)9-4-6-10(7-5-9)17(22,23)11-12(18)14(20)16(27(24,25)26)15(21)13(11)19/h4-8H,3H2,1-2H3,(H,24,25,26) |
| InChIKey | IJHMZTSUJYIVIK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|