C15H14F10O4S — CID 121422739
2-[3-(4-butan-2-ylphenyl)-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 121422739) has the molecular formula C15H14F10O4S and a molecular weight of 480.32 g/mol. Its IUPAC name is 2-[3-(4-butan-2-ylphenyl)-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[3-(4-butan-2-ylphenyl)-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 121422739 |
| Molecular Formula | C15H14F10O4S |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 2-[3-(4-butan-2-ylphenyl)-1,1,2,2,3,3-hexafluoropropoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCC(C)c1ccc(C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H14F10O4S/c1-3-8(2)9-4-6-10(7-5-9)11(16,17)12(18,19)13(20,21)29-14(22,23)15(24,25)30(26,27)28/h4-8H,3H2,1-2H3,(H,26,27,28) |
| InChIKey | AADAISOIAFHJFM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|