C6H3F4NO4S2 — CID 126656758
2,3,4,6-tetrafluoro-5-sulfinamoylbenzenesulfonic acid (PubChem CID 126656758) has the molecular formula C6H3F4NO4S2 and a molecular weight of 293.22 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-sulfinamoylbenzenesulfonic acid.
| Compound Name | 2,3,4,6-tetrafluoro-5-sulfinamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 126656758 |
| Molecular Formula | C6H3F4NO4S2 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-sulfinamoylbenzenesulfonic acid |
| SMILES | NS(=O)c1c(F)c(F)c(F)c(S(=O)(=O)O)c1F |
| InChI | InChI=1S/C6H3F4NO4S2/c7-1-2(8)5(16(11)12)4(10)6(3(1)9)17(13,14)15/h11H2,(H,13,14,15) |
| InChIKey | VOTOVSBCOWAIDA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|