About CID 53425747
CID 53425747 (PubChem CID 53425747) has the molecular formula C14H12F5OSi
and a molecular weight of 319.33 g/mol.
Molecular Properties
| Compound Name | CID 53425747 |
| PubChem CID | 53425747 |
| Molecular Formula | C14H12F5OSi |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC1(F)C(F)=C(F)C(F)=C(F)C1c1ccccc1 |
| InChI | InChI=1S/C14H12F5OSi/c1-21(2)20-14(19)9(8-6-4-3-5-7-8)10(15)11(16)12(17)13(14)18/h3-7,9H,1-2H3 |
| InChIKey | MNFVTVCQYFALHO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 53425747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53425747?
The IUPAC name of CID 53425747 (CID 53425747) is not available.
What is the SMILES notation for CID 53425747?
The canonical SMILES for CID 53425747 is C[Si](C)OC1(F)C(F)=C(F)C(F)=C(F)C1c1ccccc1.
What is the InChIKey of CID 53425747?
The InChIKey is MNFVTVCQYFALHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F5OSi/c1-21(2)20-14(19)9(8-6-4-3-5-7-8)10(15)11(16)12(17)13(14)18/h3-7,9H,1-2H3.
What are the key properties of CID 53425747?
CID 53425747 has a molecular weight of 319.33 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53425747 is sourced from PubChem (CID 53425747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).