C14H13F5OSi — CID 57353025
dimethyl-(1,2,3,4,5-pentafluoro-6-phenylcyclohexa-2,4-dien-1-yl)oxysilane (PubChem CID 57353025) has the molecular formula C14H13F5OSi and a molecular weight of 320.33 g/mol. Its IUPAC name is dimethyl-(1,2,3,4,5-pentafluoro-6-phenylcyclohexa-2,4-dien-1-yl)oxysilane.
| Compound Name | dimethyl-(1,2,3,4,5-pentafluoro-6-phenylcyclohexa-2,4-dien-1-yl)oxysilane |
|---|---|
| PubChem CID | 57353025 |
| Molecular Formula | C14H13F5OSi |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | dimethyl-(1,2,3,4,5-pentafluoro-6-phenylcyclohexa-2,4-dien-1-yl)oxysilane |
| SMILES | C[SiH](C)OC1(F)C(F)=C(F)C(F)=C(F)C1c1ccccc1 |
| InChI | InChI=1S/C14H13F5OSi/c1-21(2)20-14(19)9(8-6-4-3-5-7-8)10(15)11(16)12(17)13(14)18/h3-7,9,21H,1-2H3 |
| InChIKey | FYFRZGRYXNHGFQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|