C6H8F4O4 — CID 131865258
(2R,5S,6R)-3,3,4,4-tetrafluoro-6-(hydroxymethyl)oxane-2,5-diol (PubChem CID 131865258) has the molecular formula C6H8F4O4 and a molecular weight of 220.12 g/mol. Its IUPAC name is (2R,5S,6R)-3,3,4,4-tetrafluoro-6-(hydroxymethyl)oxane-2,5-diol.
| Compound Name | (2R,5S,6R)-3,3,4,4-tetrafluoro-6-(hydroxymethyl)oxane-2,5-diol |
|---|---|
| PubChem CID | 131865258 |
| Molecular Formula | C6H8F4O4 |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (2R,5S,6R)-3,3,4,4-tetrafluoro-6-(hydroxymethyl)oxane-2,5-diol |
| SMILES | OC[C@H]1O[C@@H](O)C(F)(F)C(F)(F)[C@H]1O |
| InChI | InChI=1S/C6H8F4O4/c7-5(8)3(12)2(1-11)14-4(13)6(5,9)10/h2-4,11-13H,1H2/t2-,3+,4-/m1/s1 |
| InChIKey | WPOYBDGMVUXNOV-FLRLBIABSA-N |
| XLogP | -0.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|