C7H13FO4 — CID 68979706
(4R)-4-fluoro-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol (PubChem CID 68979706) has the molecular formula C7H13FO4 and a molecular weight of 180.17 g/mol. Its IUPAC name is (4R)-4-fluoro-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol.
| Compound Name | (4R)-4-fluoro-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 68979706 |
| Molecular Formula | C7H13FO4 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (4R)-4-fluoro-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol |
| SMILES | COC1OC(CO)C(O)[C@@]1(C)F |
| InChI | InChI=1S/C7H13FO4/c1-7(8)5(10)4(3-9)12-6(7)11-2/h4-6,9-10H,3H2,1-2H3/t4?,5?,6?,7-/m1/s1 |
| InChIKey | SSGQJSREXILTNE-MXFXWPKCSA-N |
| XLogP | -0.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |