C9H18O6 — CID 22887228
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-3,4-dimethyloxane-3,4,5-triol (PubChem CID 22887228) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-3,4-dimethyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-3,4-dimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22887228 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-methoxy-3,4-dimethyloxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@](C)(O)[C@@]1(C)O |
| InChI | InChI=1S/C9H18O6/c1-8(12)6(11)5(4-10)15-7(14-3)9(8,2)13/h5-7,10-13H,4H2,1-3H3/t5-,6+,7-,8+,9+/m1/s1 |
| InChIKey | IWKLRGPKTPQDOR-DMAGGPPCSA-N |
| XLogP | -1.79 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |