C10H18O5 — CID 71229435
[(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 71229435) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 71229435 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | COC1O[C@H](CO)[C@H]2OC(C)(C)O[C@@]12C |
| InChI | InChI=1S/C10H18O5/c1-9(2)14-7-6(5-11)13-8(12-4)10(7,3)15-9/h6-8,11H,5H2,1-4H3/t6-,7-,8?,10-/m1/s1 |
| InChIKey | YPRPSPOCGMTAJS-VZTUGXDPSA-N |
| XLogP | 0.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |