C11H20O5 — CID 71229428
(1S)-1-[(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethanol (PubChem CID 71229428) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1S)-1-[(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethanol.
| Compound Name | (1S)-1-[(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethanol |
|---|---|
| PubChem CID | 71229428 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (1S)-1-[(3aR,6R,6aR)-4-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethanol |
| SMILES | COC1O[C@H]([C@H](C)O)[C@H]2OC(C)(C)O[C@@]12C |
| InChI | InChI=1S/C11H20O5/c1-6(12)7-8-11(4,9(13-5)14-7)16-10(2,3)15-8/h6-9,12H,1-5H3/t6-,7+,8+,9?,11+/m0/s1 |
| InChIKey | TYAKRYCYIKFEKZ-OBQLMSFRSA-N |
| XLogP | 0.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |