C9H9F9O5 — CID 163323930
5-(hydroxymethyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane-2,3,4-triol (PubChem CID 163323930) has the molecular formula C9H9F9O5 and a molecular weight of 368.15 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane-2,3,4-triol.
| Compound Name | 5-(hydroxymethyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 163323930 |
| Molecular Formula | C9H9F9O5 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 5-(hydroxymethyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane-2,3,4-triol |
| SMILES | OCC1OC(O)C(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1O |
| InChI | InChI=1S/C9H9F9O5/c10-6(11,7(12,13)8(14,15)9(16,17)18)5(22)3(20)2(1-19)23-4(5)21/h2-4,19-22H,1H2 |
| InChIKey | TUQKZNYBICDFSC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|