C10H11F9O6 — CID 18664166
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane-2,3,4,5-tetrol (PubChem CID 18664166) has the molecular formula C10H11F9O6 and a molecular weight of 398.17 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 18664166 |
| Molecular Formula | C10H11F9O6 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@](O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H11F9O6/c11-7(12,8(13,14)9(15,16)10(17,18)19)6(24)5(23)4(22)3(21)2(1-20)25-6/h2-5,20-24H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | BYVIQKHVECEBHV-VFUOTHLCSA-N |
| XLogP | -0.38 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|