C6F10O2 — CID 11403631
2,2,3,3,4,5,5,6,6-nonafluorooxane-4-carbonyl fluoride (PubChem CID 11403631) has the molecular formula C6F10O2 and a molecular weight of 294.04 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6-nonafluorooxane-4-carbonyl fluoride.
| Compound Name | 2,2,3,3,4,5,5,6,6-nonafluorooxane-4-carbonyl fluoride |
|---|---|
| PubChem CID | 11403631 |
| Molecular Formula | C6F10O2 |
| Molecular Weight | 294.04 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6-nonafluorooxane-4-carbonyl fluoride |
| SMILES | O=C(F)C1(F)C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C6F10O2/c7-1(17)2(8)3(9,10)5(13,14)18-6(15,16)4(2,11)12 |
| InChIKey | TXHSDEAKSLWKGH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.04 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|