C11HF17O2 — CID 19382044
1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carboxylic acid (PubChem CID 19382044) has the molecular formula C11HF17O2 and a molecular weight of 488.09 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carboxylic acid.
| Compound Name | 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 19382044 |
| Molecular Formula | C11HF17O2 |
| Molecular Weight | 488.09 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-heptadecafluoronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C11HF17O2/c12-2(1(29)30)3(13)4(14,7(19,20)9(23,24)5(2,15)16)8(21,22)11(27,28)10(25,26)6(3,17)18/h(H,29,30) |
| InChIKey | RPCJUZVLLKTWTL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|