C7H4F8O3 — CID 154143640
2-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxycyclopentyl)acetic acid (PubChem CID 154143640) has the molecular formula C7H4F8O3 and a molecular weight of 288.09 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxycyclopentyl)acetic acid.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxycyclopentyl)acetic acid |
|---|---|
| PubChem CID | 154143640 |
| Molecular Formula | C7H4F8O3 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxycyclopentyl)acetic acid |
| SMILES | O=C(O)CC1(O)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H4F8O3/c8-4(9)3(18,1-2(16)17)5(10,11)7(14,15)6(4,12)13/h18H,1H2,(H,16,17) |
| InChIKey | AGLPHTGLOCATNP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|