1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid

C9H12F2O4 — CID 176916515

IUPAC1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid
SMILESO=C(O)CC1(C(=O)O)CCC(F)(F)CC1
InChIInChI=1S/C9H12F2O4/c10-9(11)3-1-8(2-4-9,7(14)15)5-6(12)13/h1-5H2,(H,12,13)(H,14,15)
InChIKeyHKIVYECHXBIALN-UHFFFAOYSA-N
MW222.19 g/mol
LogP1.74
Rot. Bonds3

About 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid

1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid (PubChem CID 176916515) has the molecular formula C9H12F2O4 and a molecular weight of 222.19 g/mol. Its IUPAC name is 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid
PubChem CID176916515
Molecular FormulaC9H12F2O4
Molecular Weight222.19 g/mol
Exact Mass222.07
IUPAC Name1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid
SMILESO=C(O)CC1(C(=O)O)CCC(F)(F)CC1
InChIInChI=1S/C9H12F2O4/c10-9(11)3-1-8(2-4-9,7(14)15)5-6(12)13/h1-5H2,(H,12,13)(H,14,15)
InChIKeyHKIVYECHXBIALN-UHFFFAOYSA-N
XLogP1.74
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.19
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The IUPAC name of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid (CID 176916515) is 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid is O=C(O)CC1(C(=O)O)CCC(F)(F)CC1.
What is the InChIKey of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The InChIKey is HKIVYECHXBIALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O4/c10-9(11)3-1-8(2-4-9,7(14)15)5-6(12)13/h1-5H2,(H,12,13)(H,14,15).
What are the key properties of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid has a molecular weight of 222.19 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid is sourced from PubChem (CID 176916515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).