About 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid
1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid (PubChem CID 176916515) has the molecular formula C9H12F2O4
and a molecular weight of 222.19 g/mol. Its IUPAC name is 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid.
Analyze 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The IUPAC name of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid (CID 176916515) is 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid is O=C(O)CC1(C(=O)O)CCC(F)(F)CC1.
What is the InChIKey of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
The InChIKey is HKIVYECHXBIALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O4/c10-9(11)3-1-8(2-4-9,7(14)15)5-6(12)13/h1-5H2,(H,12,13)(H,14,15).
What are the key properties of 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid?
1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid has a molecular weight of 222.19 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(carboxymethyl)-4,4-difluorocyclohexane-1-carboxylic acid is sourced from PubChem (CID 176916515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).