C9H15F2NO3 — CID 165457571
2-[4,4-difluoro-1-(methylaminooxy)cyclohexyl]acetic acid (PubChem CID 165457571) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-[4,4-difluoro-1-(methylaminooxy)cyclohexyl]acetic acid.
| Compound Name | 2-[4,4-difluoro-1-(methylaminooxy)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 165457571 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[4,4-difluoro-1-(methylaminooxy)cyclohexyl]acetic acid |
| SMILES | CNOC1(CC(=O)O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H15F2NO3/c1-12-15-8(6-7(13)14)2-4-9(10,11)5-3-8/h12H,2-6H2,1H3,(H,13,14) |
| InChIKey | HAGKCZXEMALCLH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|