1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid

C10H16O4 — CID 90414341

IUPAC1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid
SMILESCC1(C)CCC(CC(=O)O)(C(=O)O)C1
InChIInChI=1S/C10H16O4/c1-9(2)3-4-10(6-9,8(13)14)5-7(11)12/h3-6H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyQKKDGDRJJWGWQS-UHFFFAOYSA-N
MW200.23 g/mol
LogP1.74
Rot. Bonds3

About 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid

1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid (PubChem CID 90414341) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid
PubChem CID90414341
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid
SMILESCC1(C)CCC(CC(=O)O)(C(=O)O)C1
InChIInChI=1S/C10H16O4/c1-9(2)3-4-10(6-9,8(13)14)5-7(11)12/h3-6H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyQKKDGDRJJWGWQS-UHFFFAOYSA-N
XLogP1.74
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid (CID 90414341) is 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid is CC1(C)CCC(CC(=O)O)(C(=O)O)C1.
What is the InChIKey of 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid?
The InChIKey is QKKDGDRJJWGWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-9(2)3-4-10(6-9,8(13)14)5-7(11)12/h3-6H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid?
1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid has a molecular weight of 200.23 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(carboxymethyl)-3,3-dimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 90414341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).