C14H24O2 — CID 79429129
4,4-dimethyl-1-(2-methylidenebutyl)cyclohexane-1-carboxylic acid (PubChem CID 79429129) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-methylidenebutyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4,4-dimethyl-1-(2-methylidenebutyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79429129 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4,4-dimethyl-1-(2-methylidenebutyl)cyclohexane-1-carboxylic acid |
| SMILES | C=C(CC)CC1(C(=O)O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H24O2/c1-5-11(2)10-14(12(15)16)8-6-13(3,4)7-9-14/h2,5-10H2,1,3-4H3,(H,15,16) |
| InChIKey | OGHSFCRCCOXKJL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|